![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| cover.jpg | 2022-12-29 01:02 | 107K | |
| 15. M-Four.flac | 2022-12-29 03:54 | 11M | |
| 14. Mobility.flac | 2022-12-29 04:08 | 33M | |
| 13. Barracuda.flac | 2022-12-29 04:10 | 44M | |
| 12. Peace Head.flac | 2022-12-29 04:08 | 33M | |
| 11. Time Signature.flac | 2022-12-29 03:45 | 24M | |
| 10. Drug Fits the Face.flac | 2022-12-29 04:06 | 24M | |
| 09. Voodoo Child.flac | 2022-12-29 04:11 | 29M | |
| 08. Permanent Green.flac | 2022-12-29 04:11 | 33M | |
| 07. Go.flac | 2022-12-29 04:02 | 38M | |
| 06. Protect Write.flac | 2022-12-29 04:09 | 36M | |
| 05. Party Time.flac | 2022-12-29 04:10 | 28M | |
| 04. UHF 3.flac | 2022-12-29 04:11 | 36M | |
| 03. Move the Colors.flac | 2022-12-29 03:52 | 23M | |
| 02. Rock the House.flac | 2022-12-29 04:09 | 31M | |
| 01. Besame.flac | 2022-12-29 04:09 | 24M | |