![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01-The Requiem.flac | 2022-12-12 04:43 | 9.7M | |
| 02-The Radiance.flac | 2022-12-12 04:44 | 6.2M | |
| 03-Burning In The Skies.flac | 2022-12-12 18:40 | 28M | |
| 04-Empty Spaces.flac | 2022-12-12 04:44 | 1.7M | |
| 05-When They Come For Me.flac | 2022-12-12 18:40 | 33M | |
| 06-Robot Boy.flac | 2022-12-12 18:38 | 30M | |
| 07-Jornada Del Muerto.flac | 2022-12-12 04:44 | 9.5M | |
| 08-Waiting For The End.flac | 2022-12-12 18:36 | 27M | |
| 09-Blackout.flac | 2022-12-12 18:37 | 31M | |
| 10-Wretches And Kings.flac | 2022-12-12 18:34 | 27M | |
| 11-Wisdom, Justice, And Love.flac | 2022-12-12 04:44 | 7.2M | |
| 12-Iridescent.flac | 2022-12-12 18:34 | 31M | |
| 13-Fallout.flac | 2022-12-12 04:45 | 6.4M | |
| 14-The Catalyst.flac | 2022-12-12 18:39 | 37M | |
| 15-The Messenger.flac | 2022-12-12 18:28 | 16M | |
| A Thousand Suns (flac).cue | 2022-12-12 18:28 | 2.4K | |
| A Thousand Suns (wav).cue | 2022-12-12 18:28 | 2.4K | |
| Linkin Park - A Thousand Suns.log | 2022-12-12 18:28 | 6.8K | |
| cover.jpg | 2022-12-12 18:28 | 25K | |
| scans/ | 2022-12-12 18:32 | - | |